C26H58Cl2N10 — CID 71435500
1-[N'-[6-[[amino-(diaminomethylideneamino)methylidene]amino]hexyl]carbamimidoyl]-2,3-bis(2-ethylhexyl)guanidine;dihydrochloride (PubChem CID 71435500) has the molecular formula C26H58Cl2N10 and a molecular weight of 581.70 g/mol. Its IUPAC name is 1-[N'-[6-[[amino-(diaminomethylideneamino)methylidene]amino]hexyl]carbamimidoyl]-2,3-bis(2-ethylhexyl)guanidine;dihydrochloride.
| Compound Name | 1-[N'-[6-[[amino-(diaminomethylideneamino)methylidene]amino]hexyl]carbamimidoyl]-2,3-bis(2-ethylhexyl)guanidine;dihydrochloride |
|---|---|
| PubChem CID | 71435500 |
| Molecular Formula | C26H58Cl2N10 |
| Molecular Weight | 581.70 g/mol |
| Exact Mass | 580.42 |
| IUPAC Name | 1-[N'-[6-[[amino-(diaminomethylideneamino)methylidene]amino]hexyl]carbamimidoyl]-2,3-bis(2-ethylhexyl)guanidine;dihydrochloride |
| SMILES | CCCCC(CC)CNC(=NCC(CC)CCCC)NC(=NCCCCCCN=C(N)N=C(N)N)N.Cl.Cl |
| InChI | InChI=1S/C26H56N10.2ClH/c1-5-9-15-21(7-3)19-33-26(34-20-22(8-4)16-10-6-2)36-25(30)32-18-14-12-11-13-17-31-24(29)35-23(27)28;;/h21-22H,5-20H2,1-4H3,(H6,27,28,29,31,35)(H4,30,32,33,34,36);2*1H |
| InChIKey | FESSYEXKUVGNBS-UHFFFAOYSA-N |
| XLogP | — |
| TPSA | 178.00 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 38 |
| Complexity | 653 |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.70 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|