C30H31NO12 — CID 71437936
hexamethyl 3,5-dimethyl-1-azatetracyclo[8.7.0.02,7.012,15]heptadeca-2,4,6,8,10,13-hexaene-11,12,13,14,15,16-hexacarboxylate (PubChem CID 71437936) has the molecular formula C30H31NO12 and a molecular weight of 597.57 g/mol. Its IUPAC name is hexamethyl 3,5-dimethyl-1-azatetracyclo[8.7.0.02,7.012,15]heptadeca-2,4,6,8,10,13-hexaene-11,12,13,14,15,16-hexacarboxylate.
| Compound Name | hexamethyl 3,5-dimethyl-1-azatetracyclo[8.7.0.02,7.012,15]heptadeca-2,4,6,8,10,13-hexaene-11,12,13,14,15,16-hexacarboxylate |
|---|---|
| PubChem CID | 71437936 |
| Molecular Formula | C30H31NO12 |
| Molecular Weight | 597.57 g/mol |
| Exact Mass | 597.18 |
| IUPAC Name | hexamethyl 3,5-dimethyl-1-azatetracyclo[8.7.0.02,7.012,15]heptadeca-2,4,6,8,10,13-hexaene-11,12,13,14,15,16-hexacarboxylate |
| SMILES | COC(=O)C1=C2C=Cc3cc(C)cc(C)c3N2CC(C(=O)OC)C2(C(=O)OC)C(C(=O)OC)=C(C(=O)OC)C12C(=O)OC |
| InChI | InChI=1S/C30H31NO12/c1-14-11-15(2)22-16(12-14)9-10-18-19(24(33)39-4)30(28(37)43-8)21(26(35)41-6)20(25(34)40-5)29(30,27(36)42-7)17(13-31(18)22)23(32)38-3/h9-12,17H,13H2,1-8H3 |
| InChIKey | DHXSQQIMDDRTGZ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 161.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.57 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|