C24H25NO8 — CID 12600470
tetramethyl 1-(2,6-dimethylphenyl)-3a,6-dihydroindole-4,5,6,7-tetracarboxylate (PubChem CID 12600470) has the molecular formula C24H25NO8 and a molecular weight of 455.46 g/mol. Its IUPAC name is tetramethyl 1-(2,6-dimethylphenyl)-3a,6-dihydroindole-4,5,6,7-tetracarboxylate.
| Compound Name | tetramethyl 1-(2,6-dimethylphenyl)-3a,6-dihydroindole-4,5,6,7-tetracarboxylate |
|---|---|
| PubChem CID | 12600470 |
| Molecular Formula | C24H25NO8 |
| Molecular Weight | 455.46 g/mol |
| Exact Mass | 455.16 |
| IUPAC Name | tetramethyl 1-(2,6-dimethylphenyl)-3a,6-dihydroindole-4,5,6,7-tetracarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C(C(=O)OC)C(C(=O)OC)=C2C1C=CN2c1c(C)cccc1C |
| InChI | InChI=1S/C24H25NO8/c1-12-8-7-9-13(2)19(12)25-11-10-14-15(21(26)30-3)16(22(27)31-4)17(23(28)32-5)18(20(14)25)24(29)33-6/h7-11,14,17H,1-6H3 |
| InChIKey | HIXCQFJGMPMVRY-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.46 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|