C24H25NO8 — CID 101154429
tetramethyl 5-[(E)-3-[4-(dimethylamino)phenyl]prop-2-enylidene]cyclopenta-1,3-diene-1,2,3,4-tetracarboxylate (PubChem CID 101154429) has the molecular formula C24H25NO8 and a molecular weight of 455.46 g/mol. Its IUPAC name is tetramethyl 5-[(E)-3-[4-(dimethylamino)phenyl]prop-2-enylidene]cyclopenta-1,3-diene-1,2,3,4-tetracarboxylate.
| Compound Name | tetramethyl 5-[(E)-3-[4-(dimethylamino)phenyl]prop-2-enylidene]cyclopenta-1,3-diene-1,2,3,4-tetracarboxylate |
|---|---|
| PubChem CID | 101154429 |
| Molecular Formula | C24H25NO8 |
| Molecular Weight | 455.46 g/mol |
| Exact Mass | 455.16 |
| IUPAC Name | tetramethyl 5-[(E)-3-[4-(dimethylamino)phenyl]prop-2-enylidene]cyclopenta-1,3-diene-1,2,3,4-tetracarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C(C(=O)OC)=C(C(=O)OC)C1=C/C=C/c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C24H25NO8/c1-25(2)15-12-10-14(11-13-15)8-7-9-16-17(21(26)30-3)19(23(28)32-5)20(24(29)33-6)18(16)22(27)31-4/h7-13H,1-6H3/b8-7+ |
| InChIKey | BTRZQOXNBHMREQ-BQYQJAHWSA-N |
| XLogP | 1.99 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.46 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|