C26H35NO6 — CID 134843911
3-O,5-O-ditert-butyl 4-O-methyl 2,6-dimethyl-1-(4-methylphenyl)-4H-pyridine-3,4,5-tricarboxylate (PubChem CID 134843911) has the molecular formula C26H35NO6 and a molecular weight of 457.57 g/mol. Its IUPAC name is 3-O,5-O-ditert-butyl 4-O-methyl 2,6-dimethyl-1-(4-methylphenyl)-4H-pyridine-3,4,5-tricarboxylate.
| Compound Name | 3-O,5-O-ditert-butyl 4-O-methyl 2,6-dimethyl-1-(4-methylphenyl)-4H-pyridine-3,4,5-tricarboxylate |
|---|---|
| PubChem CID | 134843911 |
| Molecular Formula | C26H35NO6 |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.25 |
| IUPAC Name | 3-O,5-O-ditert-butyl 4-O-methyl 2,6-dimethyl-1-(4-methylphenyl)-4H-pyridine-3,4,5-tricarboxylate |
| SMILES | COC(=O)C1C(C(=O)OC(C)(C)C)=C(C)N(c2ccc(C)cc2)C(C)=C1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H35NO6/c1-15-11-13-18(14-12-15)27-16(2)19(23(29)32-25(4,5)6)21(22(28)31-10)20(17(27)3)24(30)33-26(7,8)9/h11-14,21H,1-10H3 |
| InChIKey | VMJKGCAZBDSESY-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|