C22H30NO7P — CID 134843988
diethyl 4-dimethoxyphosphoryl-2,6-dimethyl-1-(4-methylphenyl)-4H-pyridine-3,5-dicarboxylate (PubChem CID 134843988) has the molecular formula C22H30NO7P and a molecular weight of 451.46 g/mol. Its IUPAC name is diethyl 4-dimethoxyphosphoryl-2,6-dimethyl-1-(4-methylphenyl)-4H-pyridine-3,5-dicarboxylate.
| Compound Name | diethyl 4-dimethoxyphosphoryl-2,6-dimethyl-1-(4-methylphenyl)-4H-pyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 134843988 |
| Molecular Formula | C22H30NO7P |
| Molecular Weight | 451.46 g/mol |
| Exact Mass | 451.18 |
| IUPAC Name | diethyl 4-dimethoxyphosphoryl-2,6-dimethyl-1-(4-methylphenyl)-4H-pyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C)N(c2ccc(C)cc2)C(C)=C(C(=O)OCC)C1P(=O)(OC)OC |
| InChI | InChI=1S/C22H30NO7P/c1-8-29-21(24)18-15(4)23(17-12-10-14(3)11-13-17)16(5)19(22(25)30-9-2)20(18)31(26,27-6)28-7/h10-13,20H,8-9H2,1-7H3 |
| InChIKey | LQSVQIRSGQCTOQ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.46 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|