C25H31NO6 — CID 139644781
diethyl 1-[2-(3-ethoxy-2-methyl-3-oxoprop-1-enyl)phenyl]-2,6-dimethyl-4H-pyridine-3,5-dicarboxylate (PubChem CID 139644781) has the molecular formula C25H31NO6 and a molecular weight of 441.52 g/mol. Its IUPAC name is diethyl 1-[2-(3-ethoxy-2-methyl-3-oxoprop-1-enyl)phenyl]-2,6-dimethyl-4H-pyridine-3,5-dicarboxylate.
| Compound Name | diethyl 1-[2-(3-ethoxy-2-methyl-3-oxoprop-1-enyl)phenyl]-2,6-dimethyl-4H-pyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 139644781 |
| Molecular Formula | C25H31NO6 |
| Molecular Weight | 441.52 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | diethyl 1-[2-(3-ethoxy-2-methyl-3-oxoprop-1-enyl)phenyl]-2,6-dimethyl-4H-pyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C(C)=Cc1ccccc1N1C(C)=C(C(=O)OCC)CC(C(=O)OCC)=C1C |
| InChI | InChI=1S/C25H31NO6/c1-7-30-23(27)16(4)14-19-12-10-11-13-22(19)26-17(5)20(24(28)31-8-2)15-21(18(26)6)25(29)32-9-3/h10-14H,7-9,15H2,1-6H3 |
| InChIKey | ATXQSUSXEOSKOZ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.52 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|