C24H34NO7P — CID 134843989
diethyl 4-diethoxyphosphoryl-2,6-dimethyl-1-(4-methylphenyl)-4H-pyridine-3,5-dicarboxylate (PubChem CID 134843989) has the molecular formula C24H34NO7P and a molecular weight of 479.51 g/mol. Its IUPAC name is diethyl 4-diethoxyphosphoryl-2,6-dimethyl-1-(4-methylphenyl)-4H-pyridine-3,5-dicarboxylate.
| Compound Name | diethyl 4-diethoxyphosphoryl-2,6-dimethyl-1-(4-methylphenyl)-4H-pyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 134843989 |
| Molecular Formula | C24H34NO7P |
| Molecular Weight | 479.51 g/mol |
| Exact Mass | 479.21 |
| IUPAC Name | diethyl 4-diethoxyphosphoryl-2,6-dimethyl-1-(4-methylphenyl)-4H-pyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C)N(c2ccc(C)cc2)C(C)=C(C(=O)OCC)C1P(=O)(OCC)OCC |
| InChI | InChI=1S/C24H34NO7P/c1-8-29-23(26)20-17(6)25(19-14-12-16(5)13-15-19)18(7)21(24(27)30-9-2)22(20)33(28,31-10-3)32-11-4/h12-15,22H,8-11H2,1-7H3 |
| InChIKey | AJNBWOPMOKABNS-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.51 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|