C28H31NO6 — CID 132581570
4-O-benzyl 3-O,5-O-diethyl 2,6-dimethyl-1-(4-methylphenyl)-4H-pyridine-3,4,5-tricarboxylate (PubChem CID 132581570) has the molecular formula C28H31NO6 and a molecular weight of 477.56 g/mol. Its IUPAC name is 4-O-benzyl 3-O,5-O-diethyl 2,6-dimethyl-1-(4-methylphenyl)-4H-pyridine-3,4,5-tricarboxylate.
| Compound Name | 4-O-benzyl 3-O,5-O-diethyl 2,6-dimethyl-1-(4-methylphenyl)-4H-pyridine-3,4,5-tricarboxylate |
|---|---|
| PubChem CID | 132581570 |
| Molecular Formula | C28H31NO6 |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.22 |
| IUPAC Name | 4-O-benzyl 3-O,5-O-diethyl 2,6-dimethyl-1-(4-methylphenyl)-4H-pyridine-3,4,5-tricarboxylate |
| SMILES | CCOC(=O)C1=C(C)N(c2ccc(C)cc2)C(C)=C(C(=O)OCC)C1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C28H31NO6/c1-6-33-26(30)23-19(4)29(22-15-13-18(3)14-16-22)20(5)24(27(31)34-7-2)25(23)28(32)35-17-21-11-9-8-10-12-21/h8-16,25H,6-7,17H2,1-5H3 |
| InChIKey | FCFQKWYJULLLSC-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|