C24H29NO6 — CID 139644775
diethyl 1-[2-[3-[(2-methylpropan-2-yl)oxy]-3-oxoprop-1-enyl]phenyl]-4H-pyridine-3,5-dicarboxylate (PubChem CID 139644775) has the molecular formula C24H29NO6 and a molecular weight of 427.50 g/mol. Its IUPAC name is diethyl 1-[2-[3-[(2-methylpropan-2-yl)oxy]-3-oxoprop-1-enyl]phenyl]-4H-pyridine-3,5-dicarboxylate.
| Compound Name | diethyl 1-[2-[3-[(2-methylpropan-2-yl)oxy]-3-oxoprop-1-enyl]phenyl]-4H-pyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 139644775 |
| Molecular Formula | C24H29NO6 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | diethyl 1-[2-[3-[(2-methylpropan-2-yl)oxy]-3-oxoprop-1-enyl]phenyl]-4H-pyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=CN(c2ccccc2C=CC(=O)OC(C)(C)C)C=C(C(=O)OCC)C1 |
| InChI | InChI=1S/C24H29NO6/c1-6-29-22(27)18-14-19(23(28)30-7-2)16-25(15-18)20-11-9-8-10-17(20)12-13-21(26)31-24(3,4)5/h8-13,15-16H,6-7,14H2,1-5H3 |
| InChIKey | ZZMSHHPULNHMAJ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|