C26H34ClNO6 — CID 159919919
diethyl 1-[2-[(E)-2-methyl-3-oxo-3-pentoxyprop-1-enyl]phenyl]-4H-pyridine-3,5-dicarboxylate;hydrochloride (PubChem CID 159919919) has the molecular formula C26H34ClNO6 and a molecular weight of 492.01 g/mol. Its IUPAC name is diethyl 1-[2-[(E)-2-methyl-3-oxo-3-pentoxyprop-1-enyl]phenyl]-4H-pyridine-3,5-dicarboxylate;hydrochloride.
| Compound Name | diethyl 1-[2-[(E)-2-methyl-3-oxo-3-pentoxyprop-1-enyl]phenyl]-4H-pyridine-3,5-dicarboxylate;hydrochloride |
|---|---|
| PubChem CID | 159919919 |
| Molecular Formula | C26H34ClNO6 |
| Molecular Weight | 492.01 g/mol |
| Exact Mass | 491.21 |
| IUPAC Name | diethyl 1-[2-[(E)-2-methyl-3-oxo-3-pentoxyprop-1-enyl]phenyl]-4H-pyridine-3,5-dicarboxylate;hydrochloride |
| SMILES | CCCCCOC(=O)/C(C)=C/c1ccccc1N1C=C(C(=O)OCC)CC(C(=O)OCC)=C1.Cl |
| InChI | InChI=1S/C26H33NO6.ClH/c1-5-8-11-14-33-24(28)19(4)15-20-12-9-10-13-23(20)27-17-21(25(29)31-6-2)16-22(18-27)26(30)32-7-3;/h9-10,12-13,15,17-18H,5-8,11,14,16H2,1-4H3;1H/b19-15+; |
| InChIKey | WXSLSJQWWQPVRD-QTCZRQAZSA-N |
| XLogP | 5.35 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.01 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|