C10H20O3 — CID 71439187
(2-methyl-2-pentan-2-yl-1,3-dioxolan-4-yl)methanol (PubChem CID 71439187) has the molecular formula C10H20O3 and a molecular weight of 188.27 g/mol. Its IUPAC name is (2-methyl-2-pentan-2-yl-1,3-dioxolan-4-yl)methanol.
| Compound Name | (2-methyl-2-pentan-2-yl-1,3-dioxolan-4-yl)methanol |
|---|---|
| PubChem CID | 71439187 |
| Molecular Formula | C10H20O3 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.14 |
| IUPAC Name | (2-methyl-2-pentan-2-yl-1,3-dioxolan-4-yl)methanol |
| SMILES | CCCC(C)C1(C)OCC(CO)O1 |
| InChI | InChI=1S/C10H20O3/c1-4-5-8(2)10(3)12-7-9(6-11)13-10/h8-9,11H,4-7H2,1-3H3 |
| InChIKey | NHRYCKNLCGBRIY-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |