C10H10ClN3O2 — CID 71441372
1-[(6-chloro-3-pyridinyl)methyl]piperazine-2,3-dione (PubChem CID 71441372) has the molecular formula C10H10ClN3O2 and a molecular weight of 239.66 g/mol. Its IUPAC name is 1-[(6-chloro-3-pyridinyl)methyl]piperazine-2,3-dione.
| Compound Name | 1-[(6-chloro-3-pyridinyl)methyl]piperazine-2,3-dione |
|---|---|
| PubChem CID | 71441372 |
| Molecular Formula | C10H10ClN3O2 |
| Molecular Weight | 239.66 g/mol |
| Exact Mass | 239.05 |
| IUPAC Name | 1-[(6-chloro-3-pyridinyl)methyl]piperazine-2,3-dione |
| SMILES | O=C1NCCN(Cc2ccc(Cl)nc2)C1=O |
| InChI | InChI=1S/C10H10ClN3O2/c11-8-2-1-7(5-13-8)6-14-4-3-12-9(15)10(14)16/h1-2,5H,3-4,6H2,(H,12,15) |
| InChIKey | HVZQSNUGEHHPNR-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.66 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|