C16H32O2 — CID 71445667
(2R,3R,7R)-2-hydroxy-3,7-dimethyltetradecan-5-one (PubChem CID 71445667) has the molecular formula C16H32O2 and a molecular weight of 256.43 g/mol. Its IUPAC name is (2R,3R,7R)-2-hydroxy-3,7-dimethyltetradecan-5-one.
| Compound Name | (2R,3R,7R)-2-hydroxy-3,7-dimethyltetradecan-5-one |
|---|---|
| PubChem CID | 71445667 |
| Molecular Formula | C16H32O2 |
| Molecular Weight | 256.43 g/mol |
| Exact Mass | 256.24 |
| IUPAC Name | (2R,3R,7R)-2-hydroxy-3,7-dimethyltetradecan-5-one |
| SMILES | CCCCCCC[C@@H](C)CC(=O)C[C@@H](C)[C@@H](C)O |
| InChI | InChI=1S/C16H32O2/c1-5-6-7-8-9-10-13(2)11-16(18)12-14(3)15(4)17/h13-15,17H,5-12H2,1-4H3/t13-,14-,15-/m1/s1 |
| InChIKey | BYMFQVXEFWHGDQ-RBSFLKMASA-N |
| XLogP | 4.35 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.43 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|