C17H12N4O — CID 71447485
3-(6-pyridin-3-ylimidazo[1,2-b]pyridazin-3-yl)phenol (PubChem CID 71447485) has the molecular formula C17H12N4O and a molecular weight of 288.31 g/mol. Its IUPAC name is 3-(6-pyridin-3-ylimidazo[1,2-b]pyridazin-3-yl)phenol.
| Compound Name | 3-(6-pyridin-3-ylimidazo[1,2-b]pyridazin-3-yl)phenol |
|---|---|
| PubChem CID | 71447485 |
| Molecular Formula | C17H12N4O |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | 3-(6-pyridin-3-ylimidazo[1,2-b]pyridazin-3-yl)phenol |
| SMILES | Oc1cccc(-c2cnc3ccc(-c4cccnc4)nn23)c1 |
| InChI | InChI=1S/C17H12N4O/c22-14-5-1-3-12(9-14)16-11-19-17-7-6-15(20-21(16)17)13-4-2-8-18-10-13/h1-11,22H |
| InChIKey | QMPNKRUFLSLFBL-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 63.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |