C22H16F6N4O3 — CID 71447513
2-oxo-N-[3-(trifluoromethyl)phenyl]-3-[[2-(trifluoromethyl)phenyl]methyl]-4,5-dihydro-[1,3]oxazolo[3,2-a][1,3,5]triazepine-7-carboxamide (PubChem CID 71447513) has the molecular formula C22H16F6N4O3 and a molecular weight of 498.38 g/mol. Its IUPAC name is 2-oxo-N-[3-(trifluoromethyl)phenyl]-3-[[2-(trifluoromethyl)phenyl]methyl]-4,5-dihydro-[1,3]oxazolo[3,2-a][1,3,5]triazepine-7-carboxamide.
| Compound Name | 2-oxo-N-[3-(trifluoromethyl)phenyl]-3-[[2-(trifluoromethyl)phenyl]methyl]-4,5-dihydro-[1,3]oxazolo[3,2-a][1,3,5]triazepine-7-carboxamide |
|---|---|
| PubChem CID | 71447513 |
| Molecular Formula | C22H16F6N4O3 |
| Molecular Weight | 498.38 g/mol |
| Exact Mass | 498.11 |
| IUPAC Name | 2-oxo-N-[3-(trifluoromethyl)phenyl]-3-[[2-(trifluoromethyl)phenyl]methyl]-4,5-dihydro-[1,3]oxazolo[3,2-a][1,3,5]triazepine-7-carboxamide |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)C1=COC2=NC(=O)N(Cc3ccccc3C(F)(F)F)CCN12 |
| InChI | InChI=1S/C22H16F6N4O3/c23-21(24,25)14-5-3-6-15(10-14)29-18(33)17-12-35-20-30-19(34)31(8-9-32(17)20)11-13-4-1-2-7-16(13)22(26,27)28/h1-7,10,12H,8-9,11H2,(H,29,33) |
| InChIKey | DXFBRDPGZIVLOM-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 74.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.38 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |