C28H30N2O3 — CID 71447571
N,N-diethyl-3-[2-oxo-1-(2-phenylethyl)-5H-4,1-benzoxazepin-7-yl]benzamide (PubChem CID 71447571) has the molecular formula C28H30N2O3 and a molecular weight of 442.56 g/mol. Its IUPAC name is N,N-diethyl-3-[2-oxo-1-(2-phenylethyl)-5H-4,1-benzoxazepin-7-yl]benzamide.
| Compound Name | N,N-diethyl-3-[2-oxo-1-(2-phenylethyl)-5H-4,1-benzoxazepin-7-yl]benzamide |
|---|---|
| PubChem CID | 71447571 |
| Molecular Formula | C28H30N2O3 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | N,N-diethyl-3-[2-oxo-1-(2-phenylethyl)-5H-4,1-benzoxazepin-7-yl]benzamide |
| SMILES | CCN(CC)C(=O)c1cccc(-c2ccc3c(c2)COCC(=O)N3CCc2ccccc2)c1 |
| InChI | InChI=1S/C28H30N2O3/c1-3-29(4-2)28(32)24-12-8-11-22(17-24)23-13-14-26-25(18-23)19-33-20-27(31)30(26)16-15-21-9-6-5-7-10-21/h5-14,17-18H,3-4,15-16,19-20H2,1-2H3 |
| InChIKey | VNVAPINQWGKFCN-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |