C24H22N2O4 — CID 71447950
3-[1-[(3-methoxyphenyl)methyl]-2-oxo-5H-4,1-benzoxazepin-8-yl]benzamide (PubChem CID 71447950) has the molecular formula C24H22N2O4 and a molecular weight of 402.45 g/mol. Its IUPAC name is 3-[1-[(3-methoxyphenyl)methyl]-2-oxo-5H-4,1-benzoxazepin-8-yl]benzamide.
| Compound Name | 3-[1-[(3-methoxyphenyl)methyl]-2-oxo-5H-4,1-benzoxazepin-8-yl]benzamide |
|---|---|
| PubChem CID | 71447950 |
| Molecular Formula | C24H22N2O4 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | 3-[1-[(3-methoxyphenyl)methyl]-2-oxo-5H-4,1-benzoxazepin-8-yl]benzamide |
| SMILES | COc1cccc(CN2C(=O)COCc3ccc(-c4cccc(C(N)=O)c4)cc32)c1 |
| InChI | InChI=1S/C24H22N2O4/c1-29-21-7-2-4-16(10-21)13-26-22-12-18(8-9-20(22)14-30-15-23(26)27)17-5-3-6-19(11-17)24(25)28/h2-12H,13-15H2,1H3,(H2,25,28) |
| InChIKey | MCFGHBVOCXZHKI-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |