C21H18N4O2 — CID 143576105
3-(1-benzyl-2-oxo-3,4-dihydropyrido[2,3-b]pyrazin-7-yl)benzamide (PubChem CID 143576105) has the molecular formula C21H18N4O2 and a molecular weight of 358.40 g/mol. Its IUPAC name is 3-(1-benzyl-2-oxo-3,4-dihydropyrido[2,3-b]pyrazin-7-yl)benzamide.
| Compound Name | 3-(1-benzyl-2-oxo-3,4-dihydropyrido[2,3-b]pyrazin-7-yl)benzamide |
|---|---|
| PubChem CID | 143576105 |
| Molecular Formula | C21H18N4O2 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | 3-(1-benzyl-2-oxo-3,4-dihydropyrido[2,3-b]pyrazin-7-yl)benzamide |
| SMILES | NC(=O)c1cccc(-c2cnc3c(c2)N(Cc2ccccc2)C(=O)CN3)c1 |
| InChI | InChI=1S/C21H18N4O2/c22-20(27)16-8-4-7-15(9-16)17-10-18-21(23-11-17)24-12-19(26)25(18)13-14-5-2-1-3-6-14/h1-11H,12-13H2,(H2,22,27)(H,23,24) |
| InChIKey | AWPXENNTIWORPM-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |