C18H17N3O3 — CID 110719117
N-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-3-phenylbenzamide (PubChem CID 110719117) has the molecular formula C18H17N3O3 and a molecular weight of 323.35 g/mol. Its IUPAC name is N-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-3-phenylbenzamide.
| Compound Name | N-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-3-phenylbenzamide |
|---|---|
| PubChem CID | 110719117 |
| Molecular Formula | C18H17N3O3 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | N-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-3-phenylbenzamide |
| SMILES | O=C(NCCN1C(=O)CNC1=O)c1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C18H17N3O3/c22-16-12-20-18(24)21(16)10-9-19-17(23)15-8-4-7-14(11-15)13-5-2-1-3-6-13/h1-8,11H,9-10,12H2,(H,19,23)(H,20,24) |
| InChIKey | AVBKHTXOSFVILW-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|