C13H15N5O3 — CID 71449589
N-[2-[(4-oxopyrido[1,2-a]pyrimidin-3-yl)carbamoylamino]ethyl]acetamide (PubChem CID 71449589) has the molecular formula C13H15N5O3 and a molecular weight of 289.30 g/mol. Its IUPAC name is N-[2-[(4-oxopyrido[1,2-a]pyrimidin-3-yl)carbamoylamino]ethyl]acetamide.
| Compound Name | N-[2-[(4-oxopyrido[1,2-a]pyrimidin-3-yl)carbamoylamino]ethyl]acetamide |
|---|---|
| PubChem CID | 71449589 |
| Molecular Formula | C13H15N5O3 |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | N-[2-[(4-oxopyrido[1,2-a]pyrimidin-3-yl)carbamoylamino]ethyl]acetamide |
| SMILES | CC(=O)NCCNC(=O)Nc1cnc2ccccn2c1=O |
| InChI | InChI=1S/C13H15N5O3/c1-9(19)14-5-6-15-13(21)17-10-8-16-11-4-2-3-7-18(11)12(10)20/h2-4,7-8H,5-6H2,1H3,(H,14,19)(H2,15,17,21) |
| InChIKey | ZVFPADXXOQMNGQ-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 104.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|