About 9-cyclopentyl-2-N-(4-morpholin-4-ylphenyl)-8-N-phenylpurine-2,8-diamine
9-cyclopentyl-2-N-(4-morpholin-4-ylphenyl)-8-N-phenylpurine-2,8-diamine (PubChem CID 71450044) has the molecular formula C26H29N7O
and a molecular weight of 455.57 g/mol. Its IUPAC name is 9-cyclopentyl-2-N-(4-morpholin-4-ylphenyl)-8-N-phenylpurine-2,8-diamine.
Molecular Properties
| Compound Name | 9-cyclopentyl-2-N-(4-morpholin-4-ylphenyl)-8-N-phenylpurine-2,8-diamine |
| PubChem CID | 71450044 |
| Molecular Formula | C26H29N7O |
| Molecular Weight | 455.57 g/mol |
| Exact Mass | 455.24 |
| IUPAC Name | 9-cyclopentyl-2-N-(4-morpholin-4-ylphenyl)-8-N-phenylpurine-2,8-diamine |
| SMILES | c1ccc(Nc2nc3cnc(Nc4ccc(N5CCOCC5)cc4)nc3n2C2CCCC2)cc1 |
| InChI | InChI=1S/C26H29N7O/c1-2-6-19(7-3-1)29-26-30-23-18-27-25(31-24(23)33(26)22-8-4-5-9-22)28-20-10-12-21(13-11-20)32-14-16-34-17-15-32/h1-3,6-7,10-13,18,22H,4-5,8-9,14-17H2,(H,29,30)(H,27,28,31) |
| InChIKey | RRAOKNRZBNRGBF-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 80.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 455.57 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|
Analyze 9-cyclopentyl-2-N-(4-morpholin-4-ylphenyl)-8-N-phenylpurine-2,8-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-cyclopentyl-2-N-(4-morpholin-4-ylphenyl)-8-N-phenylpurine-2,8-diamine?
The IUPAC name of 9-cyclopentyl-2-N-(4-morpholin-4-ylphenyl)-8-N-phenylpurine-2,8-diamine (CID 71450044) is 9-cyclopentyl-2-N-(4-morpholin-4-ylphenyl)-8-N-phenylpurine-2,8-diamine.
What is the SMILES notation for 9-cyclopentyl-2-N-(4-morpholin-4-ylphenyl)-8-N-phenylpurine-2,8-diamine?
The canonical SMILES for 9-cyclopentyl-2-N-(4-morpholin-4-ylphenyl)-8-N-phenylpurine-2,8-diamine is c1ccc(Nc2nc3cnc(Nc4ccc(N5CCOCC5)cc4)nc3n2C2CCCC2)cc1.
What is the InChIKey of 9-cyclopentyl-2-N-(4-morpholin-4-ylphenyl)-8-N-phenylpurine-2,8-diamine?
The InChIKey is RRAOKNRZBNRGBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H29N7O/c1-2-6-19(7-3-1)29-26-30-23-18-27-25(31-24(23)33(26)22-8-4-5-9-22)28-20-10-12-21(13-11-20)32-14-16-34-17-15-32/h1-3,6-7,10-13,18,22H,4-5,8-9,14-17H2,(H,29,30)(H,27,28,31).
What are the key properties of 9-cyclopentyl-2-N-(4-morpholin-4-ylphenyl)-8-N-phenylpurine-2,8-diamine?
9-cyclopentyl-2-N-(4-morpholin-4-ylphenyl)-8-N-phenylpurine-2,8-diamine has a molecular weight of 455.57 g/mol, XLogP of 5.27, 6 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 9-cyclopentyl-2-N-(4-morpholin-4-ylphenyl)-8-N-phenylpurine-2,8-diamine is sourced from PubChem (CID 71450044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).