C25H24N2O2 — CID 71450679
2-[6,7-dimethoxy-3-(3-phenylphenyl)isoquinolin-1-yl]ethanamine (PubChem CID 71450679) has the molecular formula C25H24N2O2 and a molecular weight of 384.48 g/mol. Its IUPAC name is 2-[6,7-dimethoxy-3-(3-phenylphenyl)isoquinolin-1-yl]ethanamine.
| Compound Name | 2-[6,7-dimethoxy-3-(3-phenylphenyl)isoquinolin-1-yl]ethanamine |
|---|---|
| PubChem CID | 71450679 |
| Molecular Formula | C25H24N2O2 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 2-[6,7-dimethoxy-3-(3-phenylphenyl)isoquinolin-1-yl]ethanamine |
| SMILES | COc1cc2cc(-c3cccc(-c4ccccc4)c3)nc(CCN)c2cc1OC |
| InChI | InChI=1S/C25H24N2O2/c1-28-24-15-20-14-23(27-22(11-12-26)21(20)16-25(24)29-2)19-10-6-9-18(13-19)17-7-4-3-5-8-17/h3-10,13-16H,11-12,26H2,1-2H3 |
| InChIKey | BJVYPNNQZGVJAV-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |