C18H25N4OS+ — CID 7145311
(2S)-1-(4-ethylpiperazin-4-ium-1-yl)-2-(2-methylquinazolin-4-yl)sulfanylpropan-1-one (PubChem CID 7145311) has the molecular formula C18H25N4OS+ and a molecular weight of 345.49 g/mol. Its IUPAC name is (2S)-1-(4-ethylpiperazin-4-ium-1-yl)-2-(2-methylquinazolin-4-yl)sulfanylpropan-1-one.
| Compound Name | (2S)-1-(4-ethylpiperazin-4-ium-1-yl)-2-(2-methylquinazolin-4-yl)sulfanylpropan-1-one |
|---|---|
| PubChem CID | 7145311 |
| Molecular Formula | C18H25N4OS+ |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | (2S)-1-(4-ethylpiperazin-4-ium-1-yl)-2-(2-methylquinazolin-4-yl)sulfanylpropan-1-one |
| SMILES | CC[NH+]1CCN(C(=O)[C@H](C)Sc2nc(C)nc3ccccc23)CC1 |
| InChI | InChI=1S/C18H24N4OS/c1-4-21-9-11-22(12-10-21)18(23)13(2)24-17-15-7-5-6-8-16(15)19-14(3)20-17/h5-8,13H,4,9-12H2,1-3H3/p+1/t13-/m0/s1 |
| InChIKey | FAFWECXMOLSEAK-ZDUSSCGKSA-O |
| XLogP | 1.17 |
| TPSA | 50.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |