C39H63N2O4 — CID 71456093
CID 71456093 (PubChem CID 71456093) has the molecular formula C39H63N2O4 and a molecular weight of 623.94 g/mol.
| Compound Name | CID 71456093 |
|---|---|
| PubChem CID | 71456093 |
| Molecular Formula | C39H63N2O4 |
| Molecular Weight | 623.94 g/mol |
| Exact Mass | 623.48 |
| IUPAC Name | — |
| SMILES | CC1(C)[C@@H](O)CC[C@]2(C)[C@H]3C(=O)C=C4[C@@H]5C[C@@](C)(C(=O)NC6CC(C)(C)N([O])C(C)(C)C6)CC[C@]5(C)CC[C@@]4(C)[C@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C39H63N2O4/c1-32(2)21-24(22-33(3,4)41(32)45)40-31(44)36(8)17-16-35(7)18-19-38(10)25(26(35)23-36)20-27(42)30-37(9)14-13-29(43)34(5,6)28(37)12-15-39(30,38)11/h20,24,26,28-30,43H,12-19,21-23H2,1-11H3,(H,40,44)/t26-,28-,29-,30+,35+,36-,37-,38+,39+/m0/s1 |
| InChIKey | JGSXXLDEERVXGW-JCFOGTIMSA-N |
| XLogP | 7.81 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.94 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |