C44H72N3O5 — CID 71461535
CID 71461535 (PubChem CID 71461535) has the molecular formula C44H72N3O5 and a molecular weight of 723.08 g/mol.
| Compound Name | CID 71461535 |
|---|---|
| PubChem CID | 71461535 |
| Molecular Formula | C44H72N3O5 |
| Molecular Weight | 723.08 g/mol |
| Exact Mass | 722.55 |
| IUPAC Name | — |
| SMILES | CC(C)[C@H](NC(=O)[C@@]1(C)CC[C@]2(C)CC[C@]3(C)C(=CC(=O)[C@@H]4[C@@]5(C)CC[C@H](O)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]2C1)C(=O)NC1CC(C)(C)N([O])C(C)(C)C1 |
| InChI | InChI=1S/C44H72N3O5/c1-26(2)33(35(50)45-27-23-37(3,4)47(52)38(5,6)24-27)46-36(51)41(10)19-18-40(9)20-21-43(12)28(29(40)25-41)22-30(48)34-42(11)16-15-32(49)39(7,8)31(42)14-17-44(34,43)13/h22,26-27,29,31-34,49H,14-21,23-25H2,1-13H3,(H,45,50)(H,46,51)/t29-,31-,32-,33-,34+,40+,41-,42-,43+,44+/m0/s1 |
| InChIKey | UESHOHMRIFMUNC-UOEPWMDYSA-N |
| XLogP | 7.95 |
| TPSA | 118.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.08 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |