About 1-hydroxy-3H-imidazo[4,5-b]pyridin-2-one
1-hydroxy-3H-imidazo[4,5-b]pyridin-2-one (PubChem CID 71456592) has the molecular formula C6H5N3O2
and a molecular weight of 151.12 g/mol. Its IUPAC name is 1-hydroxy-3H-imidazo[4,5-b]pyridin-2-one.
Molecular Properties
| Compound Name | 1-hydroxy-3H-imidazo[4,5-b]pyridin-2-one |
| PubChem CID | 71456592 |
| Molecular Formula | C6H5N3O2 |
| Molecular Weight | 151.12 g/mol |
| Exact Mass | 151.04 |
| IUPAC Name | 1-hydroxy-3H-imidazo[4,5-b]pyridin-2-one |
| SMILES | O=c1[nH]c2ncccc2n1O |
| InChI | InChI=1S/C6H5N3O2/c10-6-8-5-4(9(6)11)2-1-3-7-5/h1-3,11H,(H,7,8,10) |
| InChIKey | BXSVNVJMZAMGGN-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.12 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxy-3H-imidazo[4,5-b]pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxy-3H-imidazo[4,5-b]pyridin-2-one?
The IUPAC name of 1-hydroxy-3H-imidazo[4,5-b]pyridin-2-one (CID 71456592) is 1-hydroxy-3H-imidazo[4,5-b]pyridin-2-one.
What is the SMILES notation for 1-hydroxy-3H-imidazo[4,5-b]pyridin-2-one?
The canonical SMILES for 1-hydroxy-3H-imidazo[4,5-b]pyridin-2-one is O=c1[nH]c2ncccc2n1O.
What is the InChIKey of 1-hydroxy-3H-imidazo[4,5-b]pyridin-2-one?
The InChIKey is BXSVNVJMZAMGGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N3O2/c10-6-8-5-4(9(6)11)2-1-3-7-5/h1-3,11H,(H,7,8,10).
What are the key properties of 1-hydroxy-3H-imidazo[4,5-b]pyridin-2-one?
1-hydroxy-3H-imidazo[4,5-b]pyridin-2-one has a molecular weight of 151.12 g/mol, XLogP of -0.04, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxy-3H-imidazo[4,5-b]pyridin-2-one is sourced from PubChem (CID 71456592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).