C22H20N2O6 — CID 71458539
2-(2-oxochromen-4-yl)oxy-N-[4-(3-oxomorpholin-4-yl)phenyl]propanamide (PubChem CID 71458539) has the molecular formula C22H20N2O6 and a molecular weight of 408.41 g/mol. Its IUPAC name is 2-(2-oxochromen-4-yl)oxy-N-[4-(3-oxomorpholin-4-yl)phenyl]propanamide.
| Compound Name | 2-(2-oxochromen-4-yl)oxy-N-[4-(3-oxomorpholin-4-yl)phenyl]propanamide |
|---|---|
| PubChem CID | 71458539 |
| Molecular Formula | C22H20N2O6 |
| Molecular Weight | 408.41 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | 2-(2-oxochromen-4-yl)oxy-N-[4-(3-oxomorpholin-4-yl)phenyl]propanamide |
| SMILES | CC(Oc1cc(=O)oc2ccccc12)C(=O)Nc1ccc(N2CCOCC2=O)cc1 |
| InChI | InChI=1S/C22H20N2O6/c1-14(29-19-12-21(26)30-18-5-3-2-4-17(18)19)22(27)23-15-6-8-16(9-7-15)24-10-11-28-13-20(24)25/h2-9,12,14H,10-11,13H2,1H3,(H,23,27) |
| InChIKey | VLLRZHJEDOOFDB-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 98.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.41 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|