C10H9ClN2OS — CID 71458813
2-[(4-chlorophenyl)sulfanylmethyl]-(1,2-15N2)1H-pyrazol-5-one (PubChem CID 71458813) has the molecular formula C10H9ClN2OS and a molecular weight of 242.70 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)sulfanylmethyl]-(1,2-15N2)1H-pyrazol-5-one.
| Compound Name | 2-[(4-chlorophenyl)sulfanylmethyl]-(1,2-15N2)1H-pyrazol-5-one |
|---|---|
| PubChem CID | 71458813 |
| Molecular Formula | C10H9ClN2OS |
| Molecular Weight | 242.70 g/mol |
| Exact Mass | 242.01 |
| IUPAC Name | 2-[(4-chlorophenyl)sulfanylmethyl]-(1,2-15N2)1H-pyrazol-5-one |
| SMILES | O=c1cc[15n](CSc2ccc(Cl)cc2)[15nH]1 |
| InChI | InChI=1S/C10H9ClN2OS/c11-8-1-3-9(4-2-8)15-7-13-6-5-10(14)12-13/h1-6H,7H2,(H,12,14)/i12+1,13+1 |
| InChIKey | QJZUJHIDWKRANS-ULRYTFMMSA-N |
| XLogP | 2.58 |
| TPSA | 37.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.70 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |