C19H26N2O3 — CID 71459396
5-benzyl-5-octyl-1,3-diazinane-2,4,6-trione (PubChem CID 71459396) has the molecular formula C19H26N2O3 and a molecular weight of 330.43 g/mol. Its IUPAC name is 5-benzyl-5-octyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-benzyl-5-octyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 71459396 |
| Molecular Formula | C19H26N2O3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | 5-benzyl-5-octyl-1,3-diazinane-2,4,6-trione |
| SMILES | CCCCCCCCC1(Cc2ccccc2)C(=O)NC(=O)NC1=O |
| InChI | InChI=1S/C19H26N2O3/c1-2-3-4-5-6-10-13-19(14-15-11-8-7-9-12-15)16(22)20-18(24)21-17(19)23/h7-9,11-12H,2-6,10,13-14H2,1H3,(H2,20,21,22,23,24) |
| InChIKey | MWKXYRJSVHPPLM-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|