C20H17NO3 — CID 71460145
5,6,7,8-tetrahydronaphthalen-1-yl 2-phenyl-1,3-oxazole-4-carboxylate (PubChem CID 71460145) has the molecular formula C20H17NO3 and a molecular weight of 319.36 g/mol. Its IUPAC name is 5,6,7,8-tetrahydronaphthalen-1-yl 2-phenyl-1,3-oxazole-4-carboxylate.
| Compound Name | 5,6,7,8-tetrahydronaphthalen-1-yl 2-phenyl-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 71460145 |
| Molecular Formula | C20H17NO3 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 5,6,7,8-tetrahydronaphthalen-1-yl 2-phenyl-1,3-oxazole-4-carboxylate |
| SMILES | O=C(Oc1cccc2c1CCCC2)c1coc(-c2ccccc2)n1 |
| InChI | InChI=1S/C20H17NO3/c22-20(17-13-23-19(21-17)15-8-2-1-3-9-15)24-18-12-6-10-14-7-4-5-11-16(14)18/h1-3,6,8-10,12-13H,4-5,7,11H2 |
| InChIKey | ZHJFANJBAZTZTG-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|