C9H10N4OS — CID 71462358
1-(2-methylpropyl)-2-sulfanylidenepurin-6-one (PubChem CID 71462358) has the molecular formula C9H10N4OS and a molecular weight of 222.27 g/mol. Its IUPAC name is 1-(2-methylpropyl)-2-sulfanylidenepurin-6-one.
| Compound Name | 1-(2-methylpropyl)-2-sulfanylidenepurin-6-one |
|---|---|
| PubChem CID | 71462358 |
| Molecular Formula | C9H10N4OS |
| Molecular Weight | 222.27 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | 1-(2-methylpropyl)-2-sulfanylidenepurin-6-one |
| SMILES | CC(C)CN1C(=O)C2=NC=NC2=NC1=S |
| InChI | InChI=1S/C9H10N4OS/c1-5(2)3-13-8(14)6-7(11-4-10-6)12-9(13)15/h4-5H,3H2,1-2H3 |
| InChIKey | OPNWLAHHKIDKHQ-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 57.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.27 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|