C21H31N5O3 — CID 71462878
N-[(5S)-5-acetamido-6-[4-(6-methyl-2-pyridinyl)piperazin-1-yl]-6-oxohexyl]prop-2-enamide (PubChem CID 71462878) has the molecular formula C21H31N5O3 and a molecular weight of 401.51 g/mol. Its IUPAC name is N-[(5S)-5-acetamido-6-[4-(6-methyl-2-pyridinyl)piperazin-1-yl]-6-oxohexyl]prop-2-enamide.
| Compound Name | N-[(5S)-5-acetamido-6-[4-(6-methyl-2-pyridinyl)piperazin-1-yl]-6-oxohexyl]prop-2-enamide |
|---|---|
| PubChem CID | 71462878 |
| Molecular Formula | C21H31N5O3 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.24 |
| IUPAC Name | N-[(5S)-5-acetamido-6-[4-(6-methyl-2-pyridinyl)piperazin-1-yl]-6-oxohexyl]prop-2-enamide |
| SMILES | C=CC(=O)NCCCC[C@H](NC(C)=O)C(=O)N1CCN(c2cccc(C)n2)CC1 |
| InChI | InChI=1S/C21H31N5O3/c1-4-20(28)22-11-6-5-9-18(24-17(3)27)21(29)26-14-12-25(13-15-26)19-10-7-8-16(2)23-19/h4,7-8,10,18H,1,5-6,9,11-15H2,2-3H3,(H,22,28)(H,24,27)/t18-/m0/s1 |
| InChIKey | VAOHHSLXZULZFJ-SFHVURJKSA-N |
| XLogP | 1.02 |
| TPSA | 94.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|