C38H62N2O2 — CID 71463401
(2R)-1-[[(1S,2S)-2-[[(2R)-2-hydroxy-9-phenylnonyl]-methylamino]cyclohexyl]-methylamino]-9-phenylnonan-2-ol (PubChem CID 71463401) has the molecular formula C38H62N2O2 and a molecular weight of 578.93 g/mol. Its IUPAC name is (2R)-1-[[(1S,2S)-2-[[(2R)-2-hydroxy-9-phenylnonyl]-methylamino]cyclohexyl]-methylamino]-9-phenylnonan-2-ol.
| Compound Name | (2R)-1-[[(1S,2S)-2-[[(2R)-2-hydroxy-9-phenylnonyl]-methylamino]cyclohexyl]-methylamino]-9-phenylnonan-2-ol |
|---|---|
| PubChem CID | 71463401 |
| Molecular Formula | C38H62N2O2 |
| Molecular Weight | 578.93 g/mol |
| Exact Mass | 578.48 |
| IUPAC Name | (2R)-1-[[(1S,2S)-2-[[(2R)-2-hydroxy-9-phenylnonyl]-methylamino]cyclohexyl]-methylamino]-9-phenylnonan-2-ol |
| SMILES | CN(C[C@H](O)CCCCCCCc1ccccc1)[C@H]1CCCC[C@@H]1N(C)C[C@H](O)CCCCCCCc1ccccc1 |
| InChI | InChI=1S/C38H62N2O2/c1-39(31-35(41)27-17-7-3-5-11-21-33-23-13-9-14-24-33)37-29-19-20-30-38(37)40(2)32-36(42)28-18-8-4-6-12-22-34-25-15-10-16-26-34/h9-10,13-16,23-26,35-38,41-42H,3-8,11-12,17-22,27-32H2,1-2H3/t35-,36-,37+,38+/m1/s1 |
| InChIKey | ZKDHOKWOLNHEJL-RNATXAOGSA-N |
| XLogP | 8.05 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.93 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|