C35H54N2O2 — CID 71463400
(2R)-1-[(1R,4R)-5-[(2R)-2-hydroxy-9-phenylnonyl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]-9-phenylnonan-2-ol (PubChem CID 71463400) has the molecular formula C35H54N2O2 and a molecular weight of 534.83 g/mol. Its IUPAC name is (2R)-1-[(1R,4R)-5-[(2R)-2-hydroxy-9-phenylnonyl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]-9-phenylnonan-2-ol.
| Compound Name | (2R)-1-[(1R,4R)-5-[(2R)-2-hydroxy-9-phenylnonyl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]-9-phenylnonan-2-ol |
|---|---|
| PubChem CID | 71463400 |
| Molecular Formula | C35H54N2O2 |
| Molecular Weight | 534.83 g/mol |
| Exact Mass | 534.42 |
| IUPAC Name | (2R)-1-[(1R,4R)-5-[(2R)-2-hydroxy-9-phenylnonyl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]-9-phenylnonan-2-ol |
| SMILES | O[C@H](CCCCCCCc1ccccc1)CN1C[C@H]2C[C@@H]1CN2C[C@H](O)CCCCCCCc1ccccc1 |
| InChI | InChI=1S/C35H54N2O2/c38-34(23-15-5-1-3-9-17-30-19-11-7-12-20-30)28-36-26-33-25-32(36)27-37(33)29-35(39)24-16-6-2-4-10-18-31-21-13-8-14-22-31/h7-8,11-14,19-22,32-35,38-39H,1-6,9-10,15-18,23-29H2/t32-,33-,34-,35-/m1/s1 |
| InChIKey | NAUSFBRCLLVQHZ-BAQBVXSRSA-N |
| XLogP | 6.63 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.83 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|