C12H13N2O2S — CID 71464784
CID 71464784 (PubChem CID 71464784) has the molecular formula C12H13N2O2S and a molecular weight of 249.31 g/mol.
| Compound Name | CID 71464784 |
|---|---|
| PubChem CID | 71464784 |
| Molecular Formula | C12H13N2O2S |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | — |
| SMILES | CC(C)COc1ccc(C(N)=O)c([S])c1C#N |
| InChI | InChI=1S/C12H13N2O2S/c1-7(2)6-16-10-4-3-8(12(14)15)11(17)9(10)5-13/h3-4,7H,6H2,1-2H3,(H2,14,15) |
| InChIKey | ONJATJQRCXADBK-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 76.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |