C27H33N7O5S2 — CID 71465117
2-[2-butyl-4-methyl-6-oxo-1-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]pyrimidin-5-yl]-N,N-dimethylethanethioamide;sulfuric acid (PubChem CID 71465117) has the molecular formula C27H33N7O5S2 and a molecular weight of 599.74 g/mol. Its IUPAC name is 2-[2-butyl-4-methyl-6-oxo-1-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]pyrimidin-5-yl]-N,N-dimethylethanethioamide;sulfuric acid.
| Compound Name | 2-[2-butyl-4-methyl-6-oxo-1-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]pyrimidin-5-yl]-N,N-dimethylethanethioamide;sulfuric acid |
|---|---|
| PubChem CID | 71465117 |
| Molecular Formula | C27H33N7O5S2 |
| Molecular Weight | 599.74 g/mol |
| Exact Mass | 599.20 |
| IUPAC Name | 2-[2-butyl-4-methyl-6-oxo-1-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]pyrimidin-5-yl]-N,N-dimethylethanethioamide;sulfuric acid |
| SMILES | CCCCc1nc(C)c(CC(=S)N(C)C)c(=O)n1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1.O=S(=O)(O)O |
| InChI | InChI=1S/C27H31N7OS.H2O4S/c1-5-6-11-24-28-18(2)23(16-25(36)33(3)4)27(35)34(24)17-19-12-14-20(15-13-19)21-9-7-8-10-22(21)26-29-31-32-30-26;1-5(2,3)4/h7-10,12-15H,5-6,11,16-17H2,1-4H3,(H,29,30,31,32);(H2,1,2,3,4) |
| InChIKey | BLTSINMFZVNQDO-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 167.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.74 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|