C32H34N6O2 — CID 67801817
5-[[3-(hydroxymethyl)phenyl]methyl]-6-methyl-2-pentyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]pyrimidin-4-one (PubChem CID 67801817) has the molecular formula C32H34N6O2 and a molecular weight of 534.66 g/mol. Its IUPAC name is 5-[[3-(hydroxymethyl)phenyl]methyl]-6-methyl-2-pentyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]pyrimidin-4-one.
| Compound Name | 5-[[3-(hydroxymethyl)phenyl]methyl]-6-methyl-2-pentyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]pyrimidin-4-one |
|---|---|
| PubChem CID | 67801817 |
| Molecular Formula | C32H34N6O2 |
| Molecular Weight | 534.66 g/mol |
| Exact Mass | 534.27 |
| IUPAC Name | 5-[[3-(hydroxymethyl)phenyl]methyl]-6-methyl-2-pentyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]pyrimidin-4-one |
| SMILES | CCCCCc1nc(C)c(Cc2cccc(CO)c2)c(=O)n1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C32H34N6O2/c1-3-4-5-13-30-33-22(2)29(19-24-9-8-10-25(18-24)21-39)32(40)38(30)20-23-14-16-26(17-15-23)27-11-6-7-12-28(27)31-34-36-37-35-31/h6-12,14-18,39H,3-5,13,19-21H2,1-2H3,(H,34,35,36,37) |
| InChIKey | HTXNXEWIOGXAOD-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.66 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|