C27H28N8O2 — CID 19391254
5-pentyl-6-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1,4,6,9-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4-diene-2,8-dione (PubChem CID 19391254) has the molecular formula C27H28N8O2 and a molecular weight of 496.58 g/mol. Its IUPAC name is 5-pentyl-6-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1,4,6,9-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4-diene-2,8-dione.
| Compound Name | 5-pentyl-6-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1,4,6,9-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4-diene-2,8-dione |
|---|---|
| PubChem CID | 19391254 |
| Molecular Formula | C27H28N8O2 |
| Molecular Weight | 496.58 g/mol |
| Exact Mass | 496.23 |
| IUPAC Name | 5-pentyl-6-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1,4,6,9-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4-diene-2,8-dione |
| SMILES | CCCCCc1nc2c(=O)n3n(c(=O)c2n1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1)CCC3 |
| InChI | InChI=1S/C27H28N8O2/c1-2-3-4-10-22-28-23-24(27(37)35-16-7-15-34(35)26(23)36)33(22)17-18-11-13-19(14-12-18)20-8-5-6-9-21(20)25-29-31-32-30-25/h5-6,8-9,11-14H,2-4,7,10,15-17H2,1H3,(H,29,30,31,32) |
| InChIKey | MMSHQLMCGJHOBI-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 116.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.58 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|