C26H26N8O2 — CID 19391249
5-butyl-6-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1,4,6,9-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4-diene-2,8-dione (PubChem CID 19391249) has the molecular formula C26H26N8O2 and a molecular weight of 482.55 g/mol. Its IUPAC name is 5-butyl-6-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1,4,6,9-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4-diene-2,8-dione.
| Compound Name | 5-butyl-6-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1,4,6,9-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4-diene-2,8-dione |
|---|---|
| PubChem CID | 19391249 |
| Molecular Formula | C26H26N8O2 |
| Molecular Weight | 482.55 g/mol |
| Exact Mass | 482.22 |
| IUPAC Name | 5-butyl-6-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1,4,6,9-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4-diene-2,8-dione |
| SMILES | CCCCc1nc2c(=O)n3n(c(=O)c2n1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1)CCC3 |
| InChI | InChI=1S/C26H26N8O2/c1-2-3-9-21-27-22-23(26(36)34-15-6-14-33(34)25(22)35)32(21)16-17-10-12-18(13-11-17)19-7-4-5-8-20(19)24-28-30-31-29-24/h4-5,7-8,10-13H,2-3,6,9,14-16H2,1H3,(H,28,29,30,31) |
| InChIKey | JLJFJRBCSIGNPY-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 116.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.55 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |