C21H22ClN3O2 — CID 71465132
6-(2-chloro-3-methoxyphenyl)-N-[(1S)-1-(3-methoxyphenyl)ethyl]-2-methylpyrimidin-4-amine (PubChem CID 71465132) has the molecular formula C21H22ClN3O2 and a molecular weight of 383.88 g/mol. Its IUPAC name is 6-(2-chloro-3-methoxyphenyl)-N-[(1S)-1-(3-methoxyphenyl)ethyl]-2-methylpyrimidin-4-amine.
| Compound Name | 6-(2-chloro-3-methoxyphenyl)-N-[(1S)-1-(3-methoxyphenyl)ethyl]-2-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 71465132 |
| Molecular Formula | C21H22ClN3O2 |
| Molecular Weight | 383.88 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | 6-(2-chloro-3-methoxyphenyl)-N-[(1S)-1-(3-methoxyphenyl)ethyl]-2-methylpyrimidin-4-amine |
| SMILES | COc1cccc([C@H](C)Nc2cc(-c3cccc(OC)c3Cl)nc(C)n2)c1 |
| InChI | InChI=1S/C21H22ClN3O2/c1-13(15-7-5-8-16(11-15)26-3)23-20-12-18(24-14(2)25-20)17-9-6-10-19(27-4)21(17)22/h5-13H,1-4H3,(H,23,24,25)/t13-/m0/s1 |
| InChIKey | NWYYGEIWRQYZHL-ZDUSSCGKSA-N |
| XLogP | 5.30 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.88 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |