C11H16O5 — CID 71466390
methyl (2R,3S,5R,6R)-2,5,6-trimethyl-8-oxo-1,7-dioxaspiro[2.5]octane-6-carboxylate (PubChem CID 71466390) has the molecular formula C11H16O5 and a molecular weight of 228.24 g/mol. Its IUPAC name is methyl (2R,3S,5R,6R)-2,5,6-trimethyl-8-oxo-1,7-dioxaspiro[2.5]octane-6-carboxylate.
| Compound Name | methyl (2R,3S,5R,6R)-2,5,6-trimethyl-8-oxo-1,7-dioxaspiro[2.5]octane-6-carboxylate |
|---|---|
| PubChem CID | 71466390 |
| Molecular Formula | C11H16O5 |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | methyl (2R,3S,5R,6R)-2,5,6-trimethyl-8-oxo-1,7-dioxaspiro[2.5]octane-6-carboxylate |
| SMILES | COC(=O)[C@]1(C)OC(=O)[C@@]2(C[C@H]1C)O[C@@H]2C |
| InChI | InChI=1S/C11H16O5/c1-6-5-11(7(2)15-11)9(13)16-10(6,3)8(12)14-4/h6-7H,5H2,1-4H3/t6-,7-,10-,11+/m1/s1 |
| InChIKey | COYQJFOFZGEQLA-CCXSFMJYSA-N |
| XLogP | 0.66 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|