C33H32N2O4S — CID 71470825
4-methylbenzenesulfonic acid;4-methyl-8-phenoxy-1-(2-phenylethyl)-2,3-dihydropyrrolo[3,2-c]quinoline (PubChem CID 71470825) has the molecular formula C33H32N2O4S and a molecular weight of 552.70 g/mol. Its IUPAC name is 4-methylbenzenesulfonic acid;4-methyl-8-phenoxy-1-(2-phenylethyl)-2,3-dihydropyrrolo[3,2-c]quinoline.
| Compound Name | 4-methylbenzenesulfonic acid;4-methyl-8-phenoxy-1-(2-phenylethyl)-2,3-dihydropyrrolo[3,2-c]quinoline |
|---|---|
| PubChem CID | 71470825 |
| Molecular Formula | C33H32N2O4S |
| Molecular Weight | 552.70 g/mol |
| Exact Mass | 552.21 |
| IUPAC Name | 4-methylbenzenesulfonic acid;4-methyl-8-phenoxy-1-(2-phenylethyl)-2,3-dihydropyrrolo[3,2-c]quinoline |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1.Cc1nc2ccc(Oc3ccccc3)cc2c2c1CCN2CCc1ccccc1 |
| InChI | InChI=1S/C26H24N2O.C7H8O3S/c1-19-23-15-17-28(16-14-20-8-4-2-5-9-20)26(23)24-18-22(12-13-25(24)27-19)29-21-10-6-3-7-11-21;1-6-2-4-7(5-3-6)11(8,9)10/h2-13,18H,14-17H2,1H3;2-5H,1H3,(H,8,9,10) |
| InChIKey | YYMPXXDNORZEPR-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.70 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|