C29H26F7N3O — CID 71470833
1,1,1,3,3,3-hexafluoro-2-[4-[4-[[4-[(5-fluoro-1H-indol-2-yl)methyl]piperazin-1-yl]methyl]phenyl]phenyl]propan-2-ol (PubChem CID 71470833) has the molecular formula C29H26F7N3O and a molecular weight of 565.53 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-[4-[4-[[4-[(5-fluoro-1H-indol-2-yl)methyl]piperazin-1-yl]methyl]phenyl]phenyl]propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-[4-[4-[[4-[(5-fluoro-1H-indol-2-yl)methyl]piperazin-1-yl]methyl]phenyl]phenyl]propan-2-ol |
|---|---|
| PubChem CID | 71470833 |
| Molecular Formula | C29H26F7N3O |
| Molecular Weight | 565.53 g/mol |
| Exact Mass | 565.20 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-[4-[4-[[4-[(5-fluoro-1H-indol-2-yl)methyl]piperazin-1-yl]methyl]phenyl]phenyl]propan-2-ol |
| SMILES | OC(c1ccc(-c2ccc(CN3CCN(Cc4cc5cc(F)ccc5[nH]4)CC3)cc2)cc1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C29H26F7N3O/c30-24-9-10-26-22(15-24)16-25(37-26)18-39-13-11-38(12-14-39)17-19-1-3-20(4-2-19)21-5-7-23(8-6-21)27(40,28(31,32)33)29(34,35)36/h1-10,15-16,37,40H,11-14,17-18H2 |
| InChIKey | HHDXEQLVDWLQIE-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 42.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.53 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |