C28H44O6 — CID 71475635
heptyl (2Z)-2-[(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)methylidene]undecanoate (PubChem CID 71475635) has the molecular formula C28H44O6 and a molecular weight of 476.65 g/mol. Its IUPAC name is heptyl (2Z)-2-[(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)methylidene]undecanoate.
| Compound Name | heptyl (2Z)-2-[(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)methylidene]undecanoate |
|---|---|
| PubChem CID | 71475635 |
| Molecular Formula | C28H44O6 |
| Molecular Weight | 476.65 g/mol |
| Exact Mass | 476.31 |
| IUPAC Name | heptyl (2Z)-2-[(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)methylidene]undecanoate |
| SMILES | CCCCCCCCC/C(=C/C1=C(C)C(=O)C(OC)=C(OC)C1=O)C(=O)OCCCCCCC |
| InChI | InChI=1S/C28H44O6/c1-6-8-10-12-13-14-16-18-22(28(31)34-19-17-15-11-9-7-2)20-23-21(3)24(29)26(32-4)27(33-5)25(23)30/h20H,6-19H2,1-5H3/b22-20- |
| InChIKey | UHXDVNWRTQTJFT-XDOYNYLZSA-N |
| XLogP | 6.54 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.65 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|