C26H28N4O5 — CID 71478393
[4-[5-[4-[(2-methoxyphenyl)carbamoylamino]phenyl]pyrimidin-2-yl]oxycyclohexyl] acetate (PubChem CID 71478393) has the molecular formula C26H28N4O5 and a molecular weight of 476.53 g/mol. Its IUPAC name is [4-[5-[4-[(2-methoxyphenyl)carbamoylamino]phenyl]pyrimidin-2-yl]oxycyclohexyl] acetate.
| Compound Name | [4-[5-[4-[(2-methoxyphenyl)carbamoylamino]phenyl]pyrimidin-2-yl]oxycyclohexyl] acetate |
|---|---|
| PubChem CID | 71478393 |
| Molecular Formula | C26H28N4O5 |
| Molecular Weight | 476.53 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | [4-[5-[4-[(2-methoxyphenyl)carbamoylamino]phenyl]pyrimidin-2-yl]oxycyclohexyl] acetate |
| SMILES | COc1ccccc1NC(=O)Nc1ccc(-c2cnc(OC3CCC(OC(C)=O)CC3)nc2)cc1 |
| InChI | InChI=1S/C26H28N4O5/c1-17(31)34-21-11-13-22(14-12-21)35-26-27-15-19(16-28-26)18-7-9-20(10-8-18)29-25(32)30-23-5-3-4-6-24(23)33-2/h3-10,15-16,21-22H,11-14H2,1-2H3,(H2,29,30,32) |
| InChIKey | BTWMSVCWWWNHLW-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 111.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.53 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |