C19H23NO3 — CID 71481723
tert-butyl N-[(2S)-5-cyclopropyl-3-oxo-1-phenylpent-4-yn-2-yl]carbamate (PubChem CID 71481723) has the molecular formula C19H23NO3 and a molecular weight of 313.40 g/mol. Its IUPAC name is tert-butyl N-[(2S)-5-cyclopropyl-3-oxo-1-phenylpent-4-yn-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-5-cyclopropyl-3-oxo-1-phenylpent-4-yn-2-yl]carbamate |
|---|---|
| PubChem CID | 71481723 |
| Molecular Formula | C19H23NO3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | tert-butyl N-[(2S)-5-cyclopropyl-3-oxo-1-phenylpent-4-yn-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1ccccc1)C(=O)C#CC1CC1 |
| InChI | InChI=1S/C19H23NO3/c1-19(2,3)23-18(22)20-16(13-15-7-5-4-6-8-15)17(21)12-11-14-9-10-14/h4-8,14,16H,9-10,13H2,1-3H3,(H,20,22)/t16-/m0/s1 |
| InChIKey | ZPXYZFZAMHZXPN-INIZCTEOSA-N |
| XLogP | 3.10 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|