C13H10N2O4 — CID 71482215
7-methoxy-3-(1,3-oxazol-2-ylamino)chromen-4-one (PubChem CID 71482215) has the molecular formula C13H10N2O4 and a molecular weight of 258.23 g/mol. Its IUPAC name is 7-methoxy-3-(1,3-oxazol-2-ylamino)chromen-4-one.
| Compound Name | 7-methoxy-3-(1,3-oxazol-2-ylamino)chromen-4-one |
|---|---|
| PubChem CID | 71482215 |
| Molecular Formula | C13H10N2O4 |
| Molecular Weight | 258.23 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | 7-methoxy-3-(1,3-oxazol-2-ylamino)chromen-4-one |
| SMILES | COc1ccc2c(=O)c(Nc3ncco3)coc2c1 |
| InChI | InChI=1S/C13H10N2O4/c1-17-8-2-3-9-11(6-8)19-7-10(12(9)16)15-13-14-4-5-18-13/h2-7H,1H3,(H,14,15) |
| InChIKey | PIEFIOJBEUXMBO-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 77.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.23 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |