C11H16BrNO — CID 71485160
3-bromo-6-(3-methoxypropyl)-2,4-dimethylpyridine (PubChem CID 71485160) has the molecular formula C11H16BrNO and a molecular weight of 258.16 g/mol. Its IUPAC name is 3-bromo-6-(3-methoxypropyl)-2,4-dimethylpyridine.
| Compound Name | 3-bromo-6-(3-methoxypropyl)-2,4-dimethylpyridine |
|---|---|
| PubChem CID | 71485160 |
| Molecular Formula | C11H16BrNO |
| Molecular Weight | 258.16 g/mol |
| Exact Mass | 257.04 |
| IUPAC Name | 3-bromo-6-(3-methoxypropyl)-2,4-dimethylpyridine |
| SMILES | COCCCc1cc(C)c(Br)c(C)n1 |
| InChI | InChI=1S/C11H16BrNO/c1-8-7-10(5-4-6-14-3)13-9(2)11(8)12/h7H,4-6H2,1-3H3 |
| InChIKey | MWXMWRJTHOOXGA-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.16 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|