C23H24N4O — CID 71487361
2-[[4-(4-methylphenyl)piperazin-1-yl]methyl]-4H-pyrrolo[1,2-a]quinazolin-5-one (PubChem CID 71487361) has the molecular formula C23H24N4O and a molecular weight of 372.47 g/mol. Its IUPAC name is 2-[[4-(4-methylphenyl)piperazin-1-yl]methyl]-4H-pyrrolo[1,2-a]quinazolin-5-one.
| Compound Name | 2-[[4-(4-methylphenyl)piperazin-1-yl]methyl]-4H-pyrrolo[1,2-a]quinazolin-5-one |
|---|---|
| PubChem CID | 71487361 |
| Molecular Formula | C23H24N4O |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | 2-[[4-(4-methylphenyl)piperazin-1-yl]methyl]-4H-pyrrolo[1,2-a]quinazolin-5-one |
| SMILES | Cc1ccc(N2CCN(Cc3cc4[nH]c(=O)c5ccccc5n4c3)CC2)cc1 |
| InChI | InChI=1S/C23H24N4O/c1-17-6-8-19(9-7-17)26-12-10-25(11-13-26)15-18-14-22-24-23(28)20-4-2-3-5-21(20)27(22)16-18/h2-9,14,16H,10-13,15H2,1H3,(H,24,28) |
| InChIKey | MOQXVCWWKNEHDW-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 43.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|